What type of compound is Tetraphosphorus Trisulfide?
What type of compound is Tetraphosphorus Trisulfide?
| IUPAC Name | |
|---|---|
| Alternative Names | Tetraphosphorus trisulfide PHOSPHORUS SESQUISULFIDE Trisulfurated phosphorus Phosphorous sesquisulfide Tetraphosphorus trisulphide |
| Molecular Formula | P4S3 |
| Molar Mass | 220.075 g/mol |
| InChI | InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2 |
What is the chemical formula of Tetraphosphorus Heptasulfide?
P4S7
Tetraphosphorus heptasulphide | P4S7 – PubChem.
What is the correct molecular formula for the compound Tetraphosphorus Hexaoxide?
P₄O₆Tetraphosphorus hexoxide / Formula
What is the formula for phosphorus pentachloride?
Cl₅PPhosphorus pentachloride / Formula
What is the chemical name for chlorine trifluoride?
Chlorine difluoride-35Cl
| PubChem CID | 141144 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | ClF2 |
| Synonyms | Chlorine difluoride-35Cl 24801-48-7 ClF2 Difluoro-lambda~3~-chloranyl DTXSID50947714 |
| Molecular Weight | 73.45 |
What is the name of the compound xef4?
Xenon tetrafluoride | F4Xe – PubChem.
What is the correct formula for Tetraphosphorus dichloride?
Tetraphosphorus
| PubChem CID | 123286 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | P4 |
| Synonyms | tetraphosphorus Phosphorus tetramer Molecular phosphorus Tetrameric phosphorus Tetraatomic phosphorus More… |
| Molecular Weight | 123.8950480 |
Is Tetraphosphorus a compound?
tetraphosphorus hexoxide | chemical compound | Britannica.
What is the formula of the compound named tetraphosphorus hexoxide?
P4O6
Tetraphosphorus hexaoxide
| PubChem CID | 123290 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | O6P4 |
| Synonyms | Tetraphosphorus hexaoxide P4O6 (P2O3)2 10248-58-5 12440-00-5 More… |
| Molecular Weight | 219.89 |
What type of compound is PCl5?
The name of the covalent compound PCl5 is phosphorus pentachloride.
Which is the correct formula for phosphorus pentachloride quizlet?
What is the molecular formula for phosphorus pentachloride? Phosphorus pentachloride has 1 phosphorus atom and 5 chlorine atoms, so its formula is PCl₅.
What is the formula for tetraphosphorus trisulphide?
Tetraphosphorus trisulphide. Formula: P4S3. Hill system formula: P4S3. CAS registry number: [1314-51-8] Formula weight: 220.093. Class: sulphide. Colour: yellow-green. Appearance:
What is tetraphosphorus heptasulfide made from?
Tetraphosphorus heptasulfide, P 4 S 7, is one of the products obtained when phosphorus and sulfur are heated in a sealed tube. Neither P 4 S 5 nor P 4 S 7 is commercially important. Tetraphosphorus decasulfur, P 4 S 10, is prepared by reaction of a stoichiometric mixture of the elements.
How do you make tetraphosphorus decasulfide?
Tetraphosphorus decasulfide, P 4 S 10, is prepared by reaction of a stoichiometric mixture of the elements. A mixed sulfide–oxide, P 4 O 6 S 4, has a structure similar to that of P 4 O 10 except sulfur atoms replace the four oxygen atoms in terminal positions.
What is the chemical name of P4S3?
Tetraphosphorus trisulfide (P 4S 3), which is also called phosphorus sesquisulfide, can be obtained by heating a stoichiometric mixture of phosphorus and sulfur at 180 °C in an inert atmosphere.